C17H26Cl2O2S — CID 159702488
4-(7-tert-butylsulfonylheptyl)-1,2-dichlorobenzene (PubChem CID 159702488) has the molecular formula C17H26Cl2O2S and a molecular weight of 365.37 g/mol. Its IUPAC name is 4-(7-tert-butylsulfonylheptyl)-1,2-dichlorobenzene.
| Compound Name | 4-(7-tert-butylsulfonylheptyl)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 159702488 |
| Molecular Formula | C17H26Cl2O2S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-(7-tert-butylsulfonylheptyl)-1,2-dichlorobenzene |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H26Cl2O2S/c1-17(2,3)22(20,21)12-8-6-4-5-7-9-14-10-11-15(18)16(19)13-14/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | NWSHMKPTQTUBIV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|