C12H17Cl2NO2S — CID 106723040
N-(2-tert-butylsulfonylethyl)-3,4-dichloroaniline (PubChem CID 106723040) has the molecular formula C12H17Cl2NO2S and a molecular weight of 310.25 g/mol. Its IUPAC name is N-(2-tert-butylsulfonylethyl)-3,4-dichloroaniline.
| Compound Name | N-(2-tert-butylsulfonylethyl)-3,4-dichloroaniline |
|---|---|
| PubChem CID | 106723040 |
| Molecular Formula | C12H17Cl2NO2S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-(2-tert-butylsulfonylethyl)-3,4-dichloroaniline |
| SMILES | CC(C)(C)S(=O)(=O)CCNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO2S/c1-12(2,3)18(16,17)7-6-15-9-4-5-10(13)11(14)8-9/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | OCCOCDPFWKJULD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |