C10H17NO2S2 — CID 106723948
N-(2-tert-butylsulfonylethyl)thiophen-3-amine (PubChem CID 106723948) has the molecular formula C10H17NO2S2 and a molecular weight of 247.38 g/mol. Its IUPAC name is N-(2-tert-butylsulfonylethyl)thiophen-3-amine.
| Compound Name | N-(2-tert-butylsulfonylethyl)thiophen-3-amine |
|---|---|
| PubChem CID | 106723948 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-(2-tert-butylsulfonylethyl)thiophen-3-amine |
| SMILES | CC(C)(C)S(=O)(=O)CCNc1ccsc1 |
| InChI | InChI=1S/C10H17NO2S2/c1-10(2,3)15(12,13)7-5-11-9-4-6-14-8-9/h4,6,8,11H,5,7H2,1-3H3 |
| InChIKey | GIKMNTFSODKAOZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |