C13H19F2NO2S2 — CID 106722976
N-(2-tert-butylsulfonylethyl)-2-(difluoromethylsulfanyl)aniline (PubChem CID 106722976) has the molecular formula C13H19F2NO2S2 and a molecular weight of 323.43 g/mol. Its IUPAC name is N-(2-tert-butylsulfonylethyl)-2-(difluoromethylsulfanyl)aniline.
| Compound Name | N-(2-tert-butylsulfonylethyl)-2-(difluoromethylsulfanyl)aniline |
|---|---|
| PubChem CID | 106722976 |
| Molecular Formula | C13H19F2NO2S2 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(2-tert-butylsulfonylethyl)-2-(difluoromethylsulfanyl)aniline |
| SMILES | CC(C)(C)S(=O)(=O)CCNc1ccccc1SC(F)F |
| InChI | InChI=1S/C13H19F2NO2S2/c1-13(2,3)20(17,18)9-8-16-10-6-4-5-7-11(10)19-12(14)15/h4-7,12,16H,8-9H2,1-3H3 |
| InChIKey | XAXFGXHLXDQJQZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |