C13H20F2N2O2S2 — CID 106057856
N-[2-(difluoromethylsulfanyl)phenyl]-3-(propylamino)propane-1-sulfonamide (PubChem CID 106057856) has the molecular formula C13H20F2N2O2S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-3-(propylamino)propane-1-sulfonamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-3-(propylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106057856 |
| Molecular Formula | C13H20F2N2O2S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-3-(propylamino)propane-1-sulfonamide |
| SMILES | CCCNCCCS(=O)(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C13H20F2N2O2S2/c1-2-8-16-9-5-10-21(18,19)17-11-6-3-4-7-12(11)20-13(14)15/h3-4,6-7,13,16-17H,2,5,8-10H2,1H3 |
| InChIKey | NDNJFEREQMBDRC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|