C11H17F2N3O2S2 — CID 106057875
1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-(difluoromethylsulfanyl)benzene (PubChem CID 106057875) has the molecular formula C11H17F2N3O2S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-(difluoromethylsulfanyl)benzene.
| Compound Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-(difluoromethylsulfanyl)benzene |
|---|---|
| PubChem CID | 106057875 |
| Molecular Formula | C11H17F2N3O2S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-(difluoromethylsulfanyl)benzene |
| SMILES | CN(CCCN)S(=O)(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C11H17F2N3O2S2/c1-16(8-4-7-14)20(17,18)15-9-5-2-3-6-10(9)19-11(12)13/h2-3,5-6,11,15H,4,7-8,14H2,1H3 |
| InChIKey | ANRQZPSFOCOKSN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |