C10H15FIN3O2S — CID 114261612
1-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-fluoro-2-iodobenzene (PubChem CID 114261612) has the molecular formula C10H15FIN3O2S and a molecular weight of 387.22 g/mol. Its IUPAC name is 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-fluoro-2-iodobenzene.
| Compound Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-fluoro-2-iodobenzene |
|---|---|
| PubChem CID | 114261612 |
| Molecular Formula | C10H15FIN3O2S |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-fluoro-2-iodobenzene |
| SMILES | CN(CCCN)S(=O)(=O)Nc1cccc(F)c1I |
| InChI | InChI=1S/C10H15FIN3O2S/c1-15(7-3-6-13)18(16,17)14-9-5-2-4-8(11)10(9)12/h2,4-5,14H,3,6-7,13H2,1H3 |
| InChIKey | ZAXARAGLPNAYDT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|