C11H15ClF3N3O2S — CID 106003027
1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-chloro-4-(trifluoromethyl)benzene (PubChem CID 106003027) has the molecular formula C11H15ClF3N3O2S and a molecular weight of 345.77 g/mol. Its IUPAC name is 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-chloro-4-(trifluoromethyl)benzene.
| Compound Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-chloro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 106003027 |
| Molecular Formula | C11H15ClF3N3O2S |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-chloro-4-(trifluoromethyl)benzene |
| SMILES | CN(CCCN)S(=O)(=O)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H15ClF3N3O2S/c1-18(6-2-5-16)21(19,20)17-10-4-3-8(7-9(10)12)11(13,14)15/h3-4,7,17H,2,5-6,16H2,1H3 |
| InChIKey | ICXRROGWUBJWAR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |