C10H14F3N3O2S — CID 61456312
1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2,3,4-trifluorobenzene (PubChem CID 61456312) has the molecular formula C10H14F3N3O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2,3,4-trifluorobenzene.
| Compound Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 61456312 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-[[3-aminopropyl(methyl)sulfamoyl]amino]-2,3,4-trifluorobenzene |
| SMILES | CN(CCCN)S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H14F3N3O2S/c1-16(6-2-5-14)19(17,18)15-8-4-3-7(11)9(12)10(8)13/h3-4,15H,2,5-6,14H2,1H3 |
| InChIKey | XZZGFBNUXVTWGG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|