C10H15Br2N3O2S — CID 106007389
2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,4-dibromobenzene (PubChem CID 106007389) has the molecular formula C10H15Br2N3O2S and a molecular weight of 401.12 g/mol. Its IUPAC name is 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,4-dibromobenzene.
| Compound Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,4-dibromobenzene |
|---|---|
| PubChem CID | 106007389 |
| Molecular Formula | C10H15Br2N3O2S |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,4-dibromobenzene |
| SMILES | CN(CCCN)S(=O)(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H15Br2N3O2S/c1-15(6-2-5-13)18(16,17)14-10-7-8(11)3-4-9(10)12/h3-4,7,14H,2,5-6,13H2,1H3 |
| InChIKey | NURUXQQBJRWDAV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |