C9H15BrN4O2S — CID 106076050
4-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-bromopyridine (PubChem CID 106076050) has the molecular formula C9H15BrN4O2S and a molecular weight of 323.22 g/mol. Its IUPAC name is 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-bromopyridine.
| Compound Name | 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-bromopyridine |
|---|---|
| PubChem CID | 106076050 |
| Molecular Formula | C9H15BrN4O2S |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-3-bromopyridine |
| SMILES | CN(CCCN)S(=O)(=O)Nc1ccncc1Br |
| InChI | InChI=1S/C9H15BrN4O2S/c1-14(6-2-4-11)17(15,16)13-9-3-5-12-7-8(9)10/h3,5,7H,2,4,6,11H2,1H3,(H,12,13) |
| InChIKey | VACZKLBIKFGUOO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |