C11H12F5NS — CID 115513442
2-(difluoromethylsulfanyl)-N-(4,4,4-trifluorobutyl)aniline (PubChem CID 115513442) has the molecular formula C11H12F5NS and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 2-(difluoromethylsulfanyl)-N-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 115513442 |
| Molecular Formula | C11H12F5NS |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(4,4,4-trifluorobutyl)aniline |
| SMILES | FC(F)Sc1ccccc1NCCCC(F)(F)F |
| InChI | InChI=1S/C11H12F5NS/c12-10(13)18-9-5-2-1-4-8(9)17-7-3-6-11(14,15)16/h1-2,4-5,10,17H,3,6-7H2 |
| InChIKey | NYKCAXSKYVZIPA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|