C12H15F2NO2S — CID 43377840
methyl 4-[2-(difluoromethylsulfanyl)anilino]butanoate (PubChem CID 43377840) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is methyl 4-[2-(difluoromethylsulfanyl)anilino]butanoate.
| Compound Name | methyl 4-[2-(difluoromethylsulfanyl)anilino]butanoate |
|---|---|
| PubChem CID | 43377840 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 4-[2-(difluoromethylsulfanyl)anilino]butanoate |
| SMILES | COC(=O)CCCNc1ccccc1SC(F)F |
| InChI | InChI=1S/C12H15F2NO2S/c1-17-11(16)7-4-8-15-9-5-2-3-6-10(9)18-12(13)14/h2-3,5-6,12,15H,4,7-8H2,1H3 |
| InChIKey | POQYYWBKSPXKMT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|