C11H14F2N2OS — CID 107529067
N-[2-[2-(difluoromethylsulfanyl)anilino]ethyl]acetamide (PubChem CID 107529067) has the molecular formula C11H14F2N2OS and a molecular weight of 260.31 g/mol. Its IUPAC name is N-[2-[2-(difluoromethylsulfanyl)anilino]ethyl]acetamide.
| Compound Name | N-[2-[2-(difluoromethylsulfanyl)anilino]ethyl]acetamide |
|---|---|
| PubChem CID | 107529067 |
| Molecular Formula | C11H14F2N2OS |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[2-[2-(difluoromethylsulfanyl)anilino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ccccc1SC(F)F |
| InChI | InChI=1S/C11H14F2N2OS/c1-8(16)14-6-7-15-9-4-2-3-5-10(9)17-11(12)13/h2-5,11,15H,6-7H2,1H3,(H,14,16) |
| InChIKey | IFABJKDTYJVIOA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|