C11H16Cl2N2 — CID 54805609
N'-(3,4-dichlorophenyl)-N-propylethane-1,2-diamine (PubChem CID 54805609) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is N'-(3,4-dichlorophenyl)-N-propylethane-1,2-diamine.
| Compound Name | N'-(3,4-dichlorophenyl)-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 54805609 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N'-(3,4-dichlorophenyl)-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N2/c1-2-5-14-6-7-15-9-3-4-10(12)11(13)8-9/h3-4,8,14-15H,2,5-7H2,1H3 |
| InChIKey | IWECXXXJUJTGSE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|