C14H13Cl3N2 — CID 54806440
N'-(2-chlorophenyl)-N-(3,4-dichlorophenyl)ethane-1,2-diamine (PubChem CID 54806440) has the molecular formula C14H13Cl3N2 and a molecular weight of 315.63 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-(3,4-dichlorophenyl)ethane-1,2-diamine.
| Compound Name | N'-(2-chlorophenyl)-N-(3,4-dichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54806440 |
| Molecular Formula | C14H13Cl3N2 |
| Molecular Weight | 315.63 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N'-(2-chlorophenyl)-N-(3,4-dichlorophenyl)ethane-1,2-diamine |
| SMILES | Clc1ccc(NCCNc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl3N2/c15-11-6-5-10(9-13(11)17)18-7-8-19-14-4-2-1-3-12(14)16/h1-6,9,18-19H,7-8H2 |
| InChIKey | DOCVGBDYJJSNQB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|