C12H20F3N3OS — CID 103213385
2-methyl-N-[2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]ethyl]propan-2-amine (PubChem CID 103213385) has the molecular formula C12H20F3N3OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-methyl-N-[2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 103213385 |
| Molecular Formula | C12H20F3N3OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-methyl-N-[2-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazol-2-yl]ethyl]propan-2-amine |
| SMILES | CC(C)(C)NCCc1nnc(CCOCC(F)(F)F)s1 |
| InChI | InChI=1S/C12H20F3N3OS/c1-11(2,3)16-6-4-9-17-18-10(20-9)5-7-19-8-12(13,14)15/h16H,4-8H2,1-3H3 |
| InChIKey | XARCFODSVBVLQH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|