C13H21F3N2OS — CID 103150625
N-[[4-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 103150625) has the molecular formula C13H21F3N2OS and a molecular weight of 310.39 g/mol. Its IUPAC name is N-[[4-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[4-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 103150625 |
| Molecular Formula | C13H21F3N2OS |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[[4-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1sc(CCOCC(F)(F)F)nc1C(C)C |
| InChI | InChI=1S/C13H21F3N2OS/c1-4-17-7-10-12(9(2)3)18-11(20-10)5-6-19-8-13(14,15)16/h9,17H,4-8H2,1-3H3 |
| InChIKey | YQDTYGMKDLOKHY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|