C13H15BrClN3S — CID 81306922
3-[5-(4-bromo-3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine (PubChem CID 81306922) has the molecular formula C13H15BrClN3S and a molecular weight of 360.71 g/mol. Its IUPAC name is 3-[5-(4-bromo-3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine.
| Compound Name | 3-[5-(4-bromo-3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 81306922 |
| Molecular Formula | C13H15BrClN3S |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 3-[5-(4-bromo-3-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylpropan-1-amine |
| SMILES | CCNCCCc1nnc(-c2ccc(Br)c(Cl)c2)s1 |
| InChI | InChI=1S/C13H15BrClN3S/c1-2-16-7-3-4-12-17-18-13(19-12)9-5-6-10(14)11(15)8-9/h5-6,8,16H,2-4,7H2,1H3 |
| InChIKey | RIFWVCQDQMWFQF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|