C12H13ClIN3S — CID 103213370
2-[5-(3-chloro-4-iodophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine (PubChem CID 103213370) has the molecular formula C12H13ClIN3S and a molecular weight of 393.68 g/mol. Its IUPAC name is 2-[5-(3-chloro-4-iodophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[5-(3-chloro-4-iodophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 103213370 |
| Molecular Formula | C12H13ClIN3S |
| Molecular Weight | 393.68 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 2-[5-(3-chloro-4-iodophenyl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1nnc(-c2ccc(I)c(Cl)c2)s1 |
| InChI | InChI=1S/C12H13ClIN3S/c1-2-15-6-5-11-16-17-12(18-11)8-3-4-10(14)9(13)7-8/h3-4,7,15H,2,5-6H2,1H3 |
| InChIKey | CXVUMYHKDIPVRU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|