C8H8BrClN4S — CID 130743853
2-(5-bromo-1-methylpyrazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole (PubChem CID 130743853) has the molecular formula C8H8BrClN4S and a molecular weight of 307.60 g/mol. Its IUPAC name is 2-(5-bromo-1-methylpyrazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(5-bromo-1-methylpyrazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130743853 |
| Molecular Formula | C8H8BrClN4S |
| Molecular Weight | 307.60 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-(5-bromo-1-methylpyrazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole |
| SMILES | Cn1ncc(-c2nnc(CCCl)s2)c1Br |
| InChI | InChI=1S/C8H8BrClN4S/c1-14-7(9)5(4-11-14)8-13-12-6(15-8)2-3-10/h4H,2-3H2,1H3 |
| InChIKey | CSCYHDKXAKBMAS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|