About methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate
methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate (PubChem CID 90383512) has the molecular formula C10H12N4O2S
and a molecular weight of 252.30 g/mol. Its IUPAC name is methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate |
| PubChem CID | 90383512 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate |
| SMILES | CCc1nnc(-c2cnn(C)c2C(=O)OC)s1 |
| InChI | InChI=1S/C10H12N4O2S/c1-4-7-12-13-9(17-7)6-5-11-14(2)8(6)10(15)16-3/h5H,4H2,1-3H3 |
| InChIKey | AEFMVHKLACBJKQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate?
The IUPAC name of methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate (CID 90383512) is methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate.
What is the SMILES notation for methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate?
The canonical SMILES for methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate is CCc1nnc(-c2cnn(C)c2C(=O)OC)s1.
What is the InChIKey of methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate?
The InChIKey is AEFMVHKLACBJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2S/c1-4-7-12-13-9(17-7)6-5-11-14(2)8(6)10(15)16-3/h5H,4H2,1-3H3.
What are the key properties of methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate?
methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate has a molecular weight of 252.30 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-methylpyrazole-5-carboxylate is sourced from PubChem (CID 90383512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).