C7H8IN5S — CID 131107739
[5-(5-iodo-1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]methanamine (PubChem CID 131107739) has the molecular formula C7H8IN5S and a molecular weight of 321.15 g/mol. Its IUPAC name is [5-(5-iodo-1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]methanamine.
| Compound Name | [5-(5-iodo-1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 131107739 |
| Molecular Formula | C7H8IN5S |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | [5-(5-iodo-1-methylpyrazol-4-yl)-1,3,4-thiadiazol-2-yl]methanamine |
| SMILES | Cn1ncc(-c2nnc(CN)s2)c1I |
| InChI | InChI=1S/C7H8IN5S/c1-13-6(8)4(3-10-13)7-12-11-5(2-9)14-7/h3H,2,9H2,1H3 |
| InChIKey | HOVOEGWLYSWZMG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|