C7H4Cl2N2OS — CID 106690457
2-(2-chlorofuran-3-yl)-5-(chloromethyl)-1,3,4-thiadiazole (PubChem CID 106690457) has the molecular formula C7H4Cl2N2OS and a molecular weight of 235.09 g/mol. Its IUPAC name is 2-(2-chlorofuran-3-yl)-5-(chloromethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(2-chlorofuran-3-yl)-5-(chloromethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 106690457 |
| Molecular Formula | C7H4Cl2N2OS |
| Molecular Weight | 235.09 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | 2-(2-chlorofuran-3-yl)-5-(chloromethyl)-1,3,4-thiadiazole |
| SMILES | ClCc1nnc(-c2ccoc2Cl)s1 |
| InChI | InChI=1S/C7H4Cl2N2OS/c8-3-5-10-11-7(13-5)4-1-2-12-6(4)9/h1-2H,3H2 |
| InChIKey | WZNRRVFKBJBOHK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.09 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|