C9H8ClN3S — CID 106754395
2-(chloromethyl)-5-(2-methyl-4-pyridinyl)-1,3,4-thiadiazole (PubChem CID 106754395) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2-methyl-4-pyridinyl)-1,3,4-thiadiazole.
| Compound Name | 2-(chloromethyl)-5-(2-methyl-4-pyridinyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 106754395 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2-(chloromethyl)-5-(2-methyl-4-pyridinyl)-1,3,4-thiadiazole |
| SMILES | Cc1cc(-c2nnc(CCl)s2)ccn1 |
| InChI | InChI=1S/C9H8ClN3S/c1-6-4-7(2-3-11-6)9-13-12-8(5-10)14-9/h2-4H,5H2,1H3 |
| InChIKey | IGVYIVMMGBEBFQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|