C13H16ClN3S — CID 58390933
2-(2-chloro-6-methyl-4-pyridinyl)-5-pentyl-1,3,4-thiadiazole (PubChem CID 58390933) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 2-(2-chloro-6-methyl-4-pyridinyl)-5-pentyl-1,3,4-thiadiazole.
| Compound Name | 2-(2-chloro-6-methyl-4-pyridinyl)-5-pentyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 58390933 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(2-chloro-6-methyl-4-pyridinyl)-5-pentyl-1,3,4-thiadiazole |
| SMILES | CCCCCc1nnc(-c2cc(C)nc(Cl)c2)s1 |
| InChI | InChI=1S/C13H16ClN3S/c1-3-4-5-6-12-16-17-13(18-12)10-7-9(2)15-11(14)8-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | NLAXLLTZFXCVOB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|