C10H12BrN3OS — CID 106856395
2-[5-(2-bromofuran-3-yl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine (PubChem CID 106856395) has the molecular formula C10H12BrN3OS and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-[5-(2-bromofuran-3-yl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[5-(2-bromofuran-3-yl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 106856395 |
| Molecular Formula | C10H12BrN3OS |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-[5-(2-bromofuran-3-yl)-1,3,4-thiadiazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1nnc(-c2ccoc2Br)s1 |
| InChI | InChI=1S/C10H12BrN3OS/c1-2-12-5-3-8-13-14-10(16-8)7-4-6-15-9(7)11/h4,6,12H,2-3,5H2,1H3 |
| InChIKey | OHGCPZYVMIESRK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|