C7H7BrClN5S — CID 130597616
2-(5-bromo-3-methyltriazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole (PubChem CID 130597616) has the molecular formula C7H7BrClN5S and a molecular weight of 308.59 g/mol. Its IUPAC name is 2-(5-bromo-3-methyltriazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(5-bromo-3-methyltriazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130597616 |
| Molecular Formula | C7H7BrClN5S |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 2-(5-bromo-3-methyltriazol-4-yl)-5-(2-chloroethyl)-1,3,4-thiadiazole |
| SMILES | Cn1nnc(Br)c1-c1nnc(CCCl)s1 |
| InChI | InChI=1S/C7H7BrClN5S/c1-14-5(6(8)11-13-14)7-12-10-4(15-7)2-3-9/h2-3H2,1H3 |
| InChIKey | AFXDUMROPVQLFN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|