C6H8Cl2N2O — CID 54852620
2-(chloromethyl)-5-(3-chloropropyl)-1,3,4-oxadiazole (PubChem CID 54852620) has the molecular formula C6H8Cl2N2O and a molecular weight of 195.05 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(3-chloropropyl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(3-chloropropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 54852620 |
| Molecular Formula | C6H8Cl2N2O |
| Molecular Weight | 195.05 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 2-(chloromethyl)-5-(3-chloropropyl)-1,3,4-oxadiazole |
| SMILES | ClCCCc1nnc(CCl)o1 |
| InChI | InChI=1S/C6H8Cl2N2O/c7-3-1-2-5-9-10-6(4-8)11-5/h1-4H2 |
| InChIKey | JQAPXDXFSQZLBH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.05 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|