C9H9ClN2OS — CID 43513413
2-(3-chloropropyl)-5-thiophen-3-yl-1,3,4-oxadiazole (PubChem CID 43513413) has the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-thiophen-3-yl-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloropropyl)-5-thiophen-3-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43513413 |
| Molecular Formula | C9H9ClN2OS |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(3-chloropropyl)-5-thiophen-3-yl-1,3,4-oxadiazole |
| SMILES | ClCCCc1nnc(-c2ccsc2)o1 |
| InChI | InChI=1S/C9H9ClN2OS/c10-4-1-2-8-11-12-9(13-8)7-3-5-14-6-7/h3,5-6H,1-2,4H2 |
| InChIKey | KSZUCQVIXWSBNW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|