C12H12ClFN2O — CID 63209997
2-(3-chloropropyl)-5-(4-fluoro-3-methylphenyl)-1,3,4-oxadiazole (PubChem CID 63209997) has the molecular formula C12H12ClFN2O and a molecular weight of 254.69 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(4-fluoro-3-methylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloropropyl)-5-(4-fluoro-3-methylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 63209997 |
| Molecular Formula | C12H12ClFN2O |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-(3-chloropropyl)-5-(4-fluoro-3-methylphenyl)-1,3,4-oxadiazole |
| SMILES | Cc1cc(-c2nnc(CCCCl)o2)ccc1F |
| InChI | InChI=1S/C12H12ClFN2O/c1-8-7-9(4-5-10(8)14)12-16-15-11(17-12)3-2-6-13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | HXGDYYKVKXKKOZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|