About 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol
5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol (PubChem CID 43513406) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol.
Molecular Properties
| Compound Name | 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol |
| PubChem CID | 43513406 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol |
| SMILES | Cc1ccc(-c2nnc(CCCCl)o2)cc1O |
| InChI | InChI=1S/C12H13ClN2O2/c1-8-4-5-9(7-10(8)16)12-15-14-11(17-12)3-2-6-13/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | FLBZHIFXAQGBKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol?
The IUPAC name of 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol (CID 43513406) is 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol.
What is the SMILES notation for 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol?
The canonical SMILES for 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol is Cc1ccc(-c2nnc(CCCCl)o2)cc1O.
What is the InChIKey of 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol?
The InChIKey is FLBZHIFXAQGBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2/c1-8-4-5-9(7-10(8)16)12-15-14-11(17-12)3-2-6-13/h4-5,7,16H,2-3,6H2,1H3.
What are the key properties of 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol?
5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol has a molecular weight of 252.70 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]-2-methylphenol is sourced from PubChem (CID 43513406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).