C9H10ClN3OS — CID 65199305
2-(3-chloropropyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole (PubChem CID 65199305) has the molecular formula C9H10ClN3OS and a molecular weight of 243.72 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloropropyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 65199305 |
| Molecular Formula | C9H10ClN3OS |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2-(3-chloropropyl)-5-(2-methyl-1,3-thiazol-4-yl)-1,3,4-oxadiazole |
| SMILES | Cc1nc(-c2nnc(CCCCl)o2)cs1 |
| InChI | InChI=1S/C9H10ClN3OS/c1-6-11-7(5-15-6)9-13-12-8(14-9)3-2-4-10/h5H,2-4H2,1H3 |
| InChIKey | JBNGNQFBXZDHFA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|