C7H9ClF2N2O2 — CID 103206274
2-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole (PubChem CID 103206274) has the molecular formula C7H9ClF2N2O2 and a molecular weight of 226.61 g/mol. Its IUPAC name is 2-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 103206274 |
| Molecular Formula | C7H9ClF2N2O2 |
| Molecular Weight | 226.61 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-(chloromethyl)-5-[2-(2,2-difluoroethoxy)ethyl]-1,3,4-oxadiazole |
| SMILES | FC(F)COCCc1nnc(CCl)o1 |
| InChI | InChI=1S/C7H9ClF2N2O2/c8-3-7-12-11-6(14-7)1-2-13-4-5(9)10/h5H,1-4H2 |
| InChIKey | WNQVABPVXQAAPT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.61 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|