C5H6KN2O3- — CID 176636050
potassium;2-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone;hydroxide (PubChem CID 176636050) has the molecular formula C5H6KN2O3- and a molecular weight of 181.21 g/mol. Its IUPAC name is potassium;2-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone;hydroxide.
| Compound Name | potassium;2-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone;hydroxide |
|---|---|
| PubChem CID | 176636050 |
| Molecular Formula | C5H6KN2O3- |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | potassium;2-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone;hydroxide |
| SMILES | Cc1nnc(C[C-]=O)o1.[K+].[OH-] |
| InChI | InChI=1S/C5H5N2O2.K.H2O/c1-4-6-7-5(9-4)2-3-8;;/h2H2,1H3;;1H2/q-1;+1;/p-1 |
| InChIKey | YWGYFWDAZCBPJY-UHFFFAOYSA-M |
| XLogP | -3.14 |
| TPSA | 85.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|