C8H11F4N3O — CID 104632921
N-[[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine (PubChem CID 104632921) has the molecular formula C8H11F4N3O and a molecular weight of 241.19 g/mol. Its IUPAC name is N-[[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 104632921 |
| Molecular Formula | C8H11F4N3O |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-[[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(C(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C8H11F4N3O/c1-2-3-13-4-5-14-15-7(16-5)8(11,12)6(9)10/h6,13H,2-4H2,1H3 |
| InChIKey | YVTMTGJMABKFJD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|