C9H16F2N4O — CID 106965364
N-(2,2-difluoroethyl)-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106965364) has the molecular formula C9H16F2N4O and a molecular weight of 234.25 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(2,2-difluoroethyl)-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106965364 |
| Molecular Formula | C9H16F2N4O |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(N(C)CC(F)F)o1 |
| InChI | InChI=1S/C9H16F2N4O/c1-3-4-12-5-8-13-14-9(16-8)15(2)6-7(10)11/h7,12H,3-6H2,1-2H3 |
| InChIKey | RJNJQQAFMGJJGL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|