C15H21FN4O — CID 106960864
N-[1-(2-fluorophenyl)ethyl]-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106960864) has the molecular formula C15H21FN4O and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)ethyl]-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[1-(2-fluorophenyl)ethyl]-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106960864 |
| Molecular Formula | C15H21FN4O |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-[1-(2-fluorophenyl)ethyl]-N-methyl-5-(propylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(N(C)C(C)c2ccccc2F)o1 |
| InChI | InChI=1S/C15H21FN4O/c1-4-9-17-10-14-18-19-15(21-14)20(3)11(2)12-7-5-6-8-13(12)16/h5-8,11,17H,4,9-10H2,1-3H3 |
| InChIKey | ACNKBQKPEWLYOM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|