C12H13ClFN3O — CID 81461380
N-[[5-(2-chloro-3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine (PubChem CID 81461380) has the molecular formula C12H13ClFN3O and a molecular weight of 269.71 g/mol. Its IUPAC name is N-[[5-(2-chloro-3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2-chloro-3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81461380 |
| Molecular Formula | C12H13ClFN3O |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-[[5-(2-chloro-3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(-c2cccc(F)c2Cl)o1 |
| InChI | InChI=1S/C12H13ClFN3O/c1-2-6-15-7-10-16-17-12(18-10)8-4-3-5-9(14)11(8)13/h3-5,15H,2,6-7H2,1H3 |
| InChIKey | JZUQXVWKCAVTFI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|