C15H16N4O — CID 62875418
N-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine (PubChem CID 62875418) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62875418 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(-c2cccc3ncccc23)o1 |
| InChI | InChI=1S/C15H16N4O/c1-2-8-16-10-14-18-19-15(20-14)12-5-3-7-13-11(12)6-4-9-17-13/h3-7,9,16H,2,8,10H2,1H3 |
| InChIKey | IWQIGBPDKBQVGT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|