C10H17F3N4O2 — CID 106961582
5-(propylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106961582) has the molecular formula C10H17F3N4O2 and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-(propylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(propylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106961582 |
| Molecular Formula | C10H17F3N4O2 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5-(propylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCCNCc1nnc(NCCOCC(F)(F)F)o1 |
| InChI | InChI=1S/C10H17F3N4O2/c1-2-3-14-6-8-16-17-9(19-8)15-4-5-18-7-10(11,12)13/h14H,2-7H2,1H3,(H,15,17) |
| InChIKey | XEAGKNYODSPJIJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|