C11H22N4O4 — CID 106970247
N-[2-(2-methoxyethoxy)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106970247) has the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106970247 |
| Molecular Formula | C11H22N4O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | COCCNCc1nnc(NCCOCCOC)o1 |
| InChI | InChI=1S/C11H22N4O4/c1-16-5-3-12-9-10-14-15-11(19-10)13-4-6-18-8-7-17-2/h12H,3-9H2,1-2H3,(H,13,15) |
| InChIKey | HBQSVWWJGNNHHJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|