C9H18N4O4S — CID 106969617
5-[(2-methoxyethylamino)methyl]-N-(2-methylsulfonylethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106969617) has the molecular formula C9H18N4O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-(2-methylsulfonylethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-(2-methylsulfonylethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106969617 |
| Molecular Formula | C9H18N4O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-(2-methylsulfonylethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COCCNCc1nnc(NCCS(C)(=O)=O)o1 |
| InChI | InChI=1S/C9H18N4O4S/c1-16-5-3-10-7-8-12-13-9(17-8)11-4-6-18(2,14)15/h10H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | VAEQJALQCHOTCN-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|