C8H17N5O3S — CID 106969077
2-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]ethanesulfonamide (PubChem CID 106969077) has the molecular formula C8H17N5O3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]ethanesulfonamide.
| Compound Name | 2-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106969077 |
| Molecular Formula | C8H17N5O3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]ethanesulfonamide |
| SMILES | CCCNCc1nnc(NCCS(N)(=O)=O)o1 |
| InChI | InChI=1S/C8H17N5O3S/c1-2-3-10-6-7-12-13-8(16-7)11-4-5-17(9,14)15/h10H,2-6H2,1H3,(H,11,13)(H2,9,14,15) |
| InChIKey | KBIHQZUEKGGUPV-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|