C11H21N5O2 — CID 106098974
3-methyl-3-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]butanamide (PubChem CID 106098974) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-methyl-3-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]butanamide.
| Compound Name | 3-methyl-3-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]butanamide |
|---|---|
| PubChem CID | 106098974 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-methyl-3-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]butanamide |
| SMILES | CCCNCc1nnc(NC(C)(C)CC(N)=O)o1 |
| InChI | InChI=1S/C11H21N5O2/c1-4-5-13-7-9-15-16-10(18-9)14-11(2,3)6-8(12)17/h13H,4-7H2,1-3H3,(H2,12,17)(H,14,16) |
| InChIKey | RBEXLJOUUGUZBX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|