C13H17N5O2 — CID 106966692
4-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]benzamide (PubChem CID 106966692) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]benzamide.
| Compound Name | 4-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 106966692 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 4-[[5-(propylaminomethyl)-1,3,4-oxadiazol-2-yl]amino]benzamide |
| SMILES | CCCNCc1nnc(Nc2ccc(C(N)=O)cc2)o1 |
| InChI | InChI=1S/C13H17N5O2/c1-2-7-15-8-11-17-18-13(20-11)16-10-5-3-9(4-6-10)12(14)19/h3-6,15H,2,7-8H2,1H3,(H2,14,19)(H,16,18) |
| InChIKey | CXVQUTFVSBHNBQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|