C11H10ClN3O3 — CID 110456314
4-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]benzoic acid (PubChem CID 110456314) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is 4-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]benzoic acid.
| Compound Name | 4-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 110456314 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-[[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nnc(CCCl)o2)cc1 |
| InChI | InChI=1S/C11H10ClN3O3/c12-6-5-9-14-15-11(18-9)13-8-3-1-7(2-4-8)10(16)17/h1-4H,5-6H2,(H,13,15)(H,16,17) |
| InChIKey | MKSZZFNTLORGLU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|