C10H8Cl3N3O — CID 106959162
5-(2-chloroethyl)-N-(2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106959162) has the molecular formula C10H8Cl3N3O and a molecular weight of 292.55 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-(2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-(2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106959162 |
| Molecular Formula | C10H8Cl3N3O |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 5-(2-chloroethyl)-N-(2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | ClCCc1nnc(Nc2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C10H8Cl3N3O/c11-5-4-8-15-16-10(17-8)14-7-3-1-2-6(12)9(7)13/h1-3H,4-5H2,(H,14,16) |
| InChIKey | RVPONOMVTBBFQH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|