C11H8ClF4N3O — CID 106957638
5-(2-chloroethyl)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106957638) has the molecular formula C11H8ClF4N3O and a molecular weight of 309.65 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106957638 |
| Molecular Formula | C11H8ClF4N3O |
| Molecular Weight | 309.65 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 5-(2-chloroethyl)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Fc1ccc(C(F)(F)F)cc1Nc1nnc(CCCl)o1 |
| InChI | InChI=1S/C11H8ClF4N3O/c12-4-3-9-18-19-10(20-9)17-8-5-6(11(14,15)16)1-2-7(8)13/h1-2,5H,3-4H2,(H,17,19) |
| InChIKey | RXPSZHKCLGPJIP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|