C12H12ClF2N3O — CID 106957536
5-(2-chloroethyl)-N-[2-(3,5-difluorophenyl)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106957536) has the molecular formula C12H12ClF2N3O and a molecular weight of 287.70 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-[2-(3,5-difluorophenyl)ethyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-[2-(3,5-difluorophenyl)ethyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106957536 |
| Molecular Formula | C12H12ClF2N3O |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-(2-chloroethyl)-N-[2-(3,5-difluorophenyl)ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Fc1cc(F)cc(CCNc2nnc(CCCl)o2)c1 |
| InChI | InChI=1S/C12H12ClF2N3O/c13-3-1-11-17-18-12(19-11)16-4-2-8-5-9(14)7-10(15)6-8/h5-7H,1-4H2,(H,16,18) |
| InChIKey | STJQWEZUYONSGR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|